C34H45BN2O7 — CID 87449903
tert-butyl 2-methoxy-3-[(2R)-2-(2-phenylmethoxyiminopropanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate (PubChem CID 87449903) has the molecular formula C34H45BN2O7 and a molecular weight of 604.55 g/mol. Its IUPAC name is tert-butyl 2-methoxy-3-[(2R)-2-(2-phenylmethoxyiminopropanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate.
| Compound Name | tert-butyl 2-methoxy-3-[(2R)-2-(2-phenylmethoxyiminopropanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 87449903 |
| Molecular Formula | C34H45BN2O7 |
| Molecular Weight | 604.55 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | tert-butyl 2-methoxy-3-[(2R)-2-(2-phenylmethoxyiminopropanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate |
| SMILES | COc1c(C[C@H](NC(=O)C(C)=NOCc2ccccc2)B2OC3CC4CC(C4(C)C)C3(C)O2)cccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H45BN2O7/c1-21(37-41-20-22-13-10-9-11-14-22)30(38)36-28(35-43-27-19-24-18-26(33(24,5)6)34(27,7)44-35)17-23-15-12-16-25(29(23)40-8)31(39)42-32(2,3)4/h9-16,24,26-28H,17-20H2,1-8H3,(H,36,38)/t24?,26?,27?,28-,34?/m0/s1 |
| InChIKey | BQNIBSJSEVWFKX-GUGALFTBSA-N |
| XLogP | 5.54 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|