C17H14O2 — CID 87450096
13-oxatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,7,11(16),14-hexaen-18-one (PubChem CID 87450096) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 13-oxatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,7,11(16),14-hexaen-18-one.
| Compound Name | 13-oxatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,7,11(16),14-hexaen-18-one |
|---|---|
| PubChem CID | 87450096 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 13-oxatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,7,11(16),14-hexaen-18-one |
| SMILES | O=C1CC2=C(COC=C2)C2=C1C1=C(C=CC2)CC=C1 |
| InChI | InChI=1S/C17H14O2/c18-16-9-12-7-8-19-10-15(12)14-6-2-4-11-3-1-5-13(11)17(14)16/h1-2,4-5,7-8H,3,6,9-10H2 |
| InChIKey | PSXJJZOUKYPSRI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |