About 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide
2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide (PubChem CID 87450661) has the molecular formula C6H15ClN2O2S
and a molecular weight of 214.72 g/mol. Its IUPAC name is 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide |
| PubChem CID | 87450661 |
| Molecular Formula | C6H15ClN2O2S |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CC(C)(C)NCl |
| InChI | InChI=1S/C6H15ClN2O2S/c1-6(2,8-7)5-12(10,11)9(3)4/h8H,5H2,1-4H3 |
| InChIKey | PNHYVWGWSQGHDP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide?
The IUPAC name of 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide (CID 87450661) is 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide.
What is the SMILES notation for 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide?
The canonical SMILES for 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide is CN(C)S(=O)(=O)CC(C)(C)NCl.
What is the InChIKey of 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide?
The InChIKey is PNHYVWGWSQGHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15ClN2O2S/c1-6(2,8-7)5-12(10,11)9(3)4/h8H,5H2,1-4H3.
What are the key properties of 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide?
2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide has a molecular weight of 214.72 g/mol, XLogP of 0.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloroamino)-N,N,2-trimethylpropane-1-sulfonamide is sourced from PubChem (CID 87450661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).