C17H15Cl6N3O — CID 87450898
1-[4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]phenyl]butan-1-ol (PubChem CID 87450898) has the molecular formula C17H15Cl6N3O and a molecular weight of 490.05 g/mol. Its IUPAC name is 1-[4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]phenyl]butan-1-ol.
| Compound Name | 1-[4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 87450898 |
| Molecular Formula | C17H15Cl6N3O |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 486.93 |
| IUPAC Name | 1-[4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]phenyl]butan-1-ol |
| SMILES | CCCC(O)c1ccc(C=Cc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C17H15Cl6N3O/c1-2-3-12(27)11-7-4-10(5-8-11)6-9-13-24-14(16(18,19)20)26-15(25-13)17(21,22)23/h4-9,12,27H,2-3H2,1H3 |
| InChIKey | YUZRNEUUSRXZSA-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|