C26H24F11NO8S2 — CID 87451147
[3-[[2,2-difluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylsulfamoyl)acetyl]oxymethyl]-1-adamantyl] 4-ethenylbenzoate (PubChem CID 87451147) has the molecular formula C26H24F11NO8S2 and a molecular weight of 751.59 g/mol. Its IUPAC name is [3-[[2,2-difluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylsulfamoyl)acetyl]oxymethyl]-1-adamantyl] 4-ethenylbenzoate.
| Compound Name | [3-[[2,2-difluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylsulfamoyl)acetyl]oxymethyl]-1-adamantyl] 4-ethenylbenzoate |
|---|---|
| PubChem CID | 87451147 |
| Molecular Formula | C26H24F11NO8S2 |
| Molecular Weight | 751.59 g/mol |
| Exact Mass | 751.08 |
| IUPAC Name | [3-[[2,2-difluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylsulfamoyl)acetyl]oxymethyl]-1-adamantyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OC23CC4CC(CC(COC(=O)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C26H24F11NO8S2/c1-2-14-3-5-17(6-4-14)18(39)46-21-10-15-7-16(11-21)9-20(8-15,12-21)13-45-19(40)22(27,28)47(41,42)38-48(43,44)26(36,37)24(31,32)23(29,30)25(33,34)35/h2-6,15-16,38H,1,7-13H2 |
| InChIKey | XFLKNQZRCWXBDT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|