C18H36O2 — CID 87451205
hexyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 87451205) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is hexyl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | hexyl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 87451205 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | hexyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CCCCCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2/c1-9-10-11-12-13-20-15(19)18(8,17(5,6)7)14-16(2,3)4/h9-14H2,1-8H3 |
| InChIKey | CJSSBCMLQVEYOQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|