About ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate
ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate (PubChem CID 87451313) has the molecular formula C18H18F2O5S
and a molecular weight of 384.40 g/mol. Its IUPAC name is ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate |
| PubChem CID | 87451313 |
| Molecular Formula | C18H18F2O5S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(F)(F)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H18F2O5S/c1-3-24-17(21)14-6-8-15(9-7-14)18(19,20)12-25-26(22,23)16-10-4-13(2)5-11-16/h4-11H,3,12H2,1-2H3 |
| InChIKey | CGIWEGVKMVKFDU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate?
The IUPAC name of ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate (CID 87451313) is ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate.
What is the SMILES notation for ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate?
The canonical SMILES for ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate is CCOC(=O)c1ccc(C(F)(F)COS(=O)(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate?
The InChIKey is CGIWEGVKMVKFDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2O5S/c1-3-24-17(21)14-6-8-15(9-7-14)18(19,20)12-25-26(22,23)16-10-4-13(2)5-11-16/h4-11H,3,12H2,1-2H3.
What are the key properties of ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate?
ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate has a molecular weight of 384.40 g/mol, XLogP of 3.67, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoate is sourced from PubChem (CID 87451313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).