C13H25F3N4O2 — CID 87451577
N-[2-[2-[di(propan-2-yl)amino]ethylcarbamoylamino]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 87451577) has the molecular formula C13H25F3N4O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-[2-[2-[di(propan-2-yl)amino]ethylcarbamoylamino]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[2-[di(propan-2-yl)amino]ethylcarbamoylamino]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87451577 |
| Molecular Formula | C13H25F3N4O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | N-[2-[2-[di(propan-2-yl)amino]ethylcarbamoylamino]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)N(CCNC(=O)NCCNC(=O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C13H25F3N4O2/c1-9(2)20(10(3)4)8-7-19-12(22)18-6-5-17-11(21)13(14,15)16/h9-10H,5-8H2,1-4H3,(H,17,21)(H2,18,19,22) |
| InChIKey | MMFKTSKJJUNMLV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|