C25H12N2O4 — CID 87451588
2-methyl-5,11-diazaheptacyclo[13.9.1.116,20.03,7.08,25.09,13.024,26]hexacosa-1,3(7),8(25),9(13),14,16,18,20(26),21,23-decaene-4,6,10,12-tetrone (PubChem CID 87451588) has the molecular formula C25H12N2O4 and a molecular weight of 404.38 g/mol. Its IUPAC name is 2-methyl-5,11-diazaheptacyclo[13.9.1.116,20.03,7.08,25.09,13.024,26]hexacosa-1,3(7),8(25),9(13),14,16,18,20(26),21,23-decaene-4,6,10,12-tetrone.
| Compound Name | 2-methyl-5,11-diazaheptacyclo[13.9.1.116,20.03,7.08,25.09,13.024,26]hexacosa-1,3(7),8(25),9(13),14,16,18,20(26),21,23-decaene-4,6,10,12-tetrone |
|---|---|
| PubChem CID | 87451588 |
| Molecular Formula | C25H12N2O4 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-methyl-5,11-diazaheptacyclo[13.9.1.116,20.03,7.08,25.09,13.024,26]hexacosa-1,3(7),8(25),9(13),14,16,18,20(26),21,23-decaene-4,6,10,12-tetrone |
| SMILES | Cc1c2c(=O)[nH]c(=O)c2c2c3c(=O)[nH]c(=O)c3cc3c4cccc5cccc(c1c32)c54 |
| InChI | InChI=1S/C25H12N2O4/c1-9-15-12-7-3-5-10-4-2-6-11(17(10)12)13-8-14-19(24(30)26-22(14)28)20(18(13)15)21-16(9)23(29)27-25(21)31/h2-8H,1H3,(H,26,28,30)(H,27,29,31) |
| InChIKey | YOCNXMRPUHBOAC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|