C11H19F3O3 — CID 87451930
butan-1-ol;1,1,1-trifluoro-5-methylhexane-2,4-dione (PubChem CID 87451930) has the molecular formula C11H19F3O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is butan-1-ol;1,1,1-trifluoro-5-methylhexane-2,4-dione.
| Compound Name | butan-1-ol;1,1,1-trifluoro-5-methylhexane-2,4-dione |
|---|---|
| PubChem CID | 87451930 |
| Molecular Formula | C11H19F3O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | butan-1-ol;1,1,1-trifluoro-5-methylhexane-2,4-dione |
| SMILES | CC(C)C(=O)CC(=O)C(F)(F)F.CCCCO |
| InChI | InChI=1S/C7H9F3O2.C4H10O/c1-4(2)5(11)3-6(12)7(8,9)10;1-2-3-4-5/h4H,3H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | IRYDKSREDGYVCJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|