C33H34F4O5S2 — CID 87451943
[3,3,4,4-tetrafluoro-4-(triphenyl-λ4-sulfanyl)oxysulfonylbutyl] adamantane-1-carboxylate (PubChem CID 87451943) has the molecular formula C33H34F4O5S2 and a molecular weight of 650.76 g/mol. Its IUPAC name is [3,3,4,4-tetrafluoro-4-(triphenyl-λ4-sulfanyl)oxysulfonylbutyl] adamantane-1-carboxylate.
| Compound Name | [3,3,4,4-tetrafluoro-4-(triphenyl-λ4-sulfanyl)oxysulfonylbutyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 87451943 |
| Molecular Formula | C33H34F4O5S2 |
| Molecular Weight | 650.76 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | [3,3,4,4-tetrafluoro-4-(triphenyl-λ4-sulfanyl)oxysulfonylbutyl] adamantane-1-carboxylate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C33H34F4O5S2/c34-32(35,16-17-41-30(38)31-21-24-18-25(22-31)20-26(19-24)23-31)33(36,37)44(39,40)42-43(27-10-4-1-5-11-27,28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-15,24-26H,16-23H2 |
| InChIKey | DEGAAXBZXMVFME-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.76 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|