C16H34N4 — CID 87452194
8-diazo-4,4,9,9-tetramethyldodecane-2,5-diamine (PubChem CID 87452194) has the molecular formula C16H34N4 and a molecular weight of 282.48 g/mol. Its IUPAC name is 8-diazo-4,4,9,9-tetramethyldodecane-2,5-diamine.
| Compound Name | 8-diazo-4,4,9,9-tetramethyldodecane-2,5-diamine |
|---|---|
| PubChem CID | 87452194 |
| Molecular Formula | C16H34N4 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.28 |
| IUPAC Name | 8-diazo-4,4,9,9-tetramethyldodecane-2,5-diamine |
| SMILES | CCCC(C)(C)C(CCC(N)C(C)(C)CC(C)N)=[N+]=[N-] |
| InChI | InChI=1S/C16H34N4/c1-7-10-15(3,4)14(20-19)9-8-13(18)16(5,6)11-12(2)17/h12-13H,7-11,17-18H2,1-6H3 |
| InChIKey | HDLGLWKUKSPDHO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|