C31H40F2O6S2 — CID 87452570
2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;1-(4-butoxynaphthalen-1-yl)thiolan-1-ium (PubChem CID 87452570) has the molecular formula C31H40F2O6S2 and a molecular weight of 610.79 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;1-(4-butoxynaphthalen-1-yl)thiolan-1-ium.
| Compound Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;1-(4-butoxynaphthalen-1-yl)thiolan-1-ium |
|---|---|
| PubChem CID | 87452570 |
| Molecular Formula | C31H40F2O6S2 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;1-(4-butoxynaphthalen-1-yl)thiolan-1-ium |
| SMILES | CCCCOc1ccc([S+]2CCCC2)c2ccccc12.O=C(OCC(F)(F)S(=O)(=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H23OS.C13H18F2O5S/c1-2-3-12-19-17-10-11-18(20-13-6-7-14-20)16-9-5-4-8-15(16)17;14-13(15,21(17,18)19)7-20-11(16)12-4-8-1-9(5-12)3-10(2-8)6-12/h4-5,8-11H,2-3,6-7,12-14H2,1H3;8-10H,1-7H2,(H,17,18,19)/q+1;/p-1 |
| InChIKey | CCYMDZTXXGZDEN-UHFFFAOYSA-M |
| XLogP | 6.67 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|