C23H23N3O2 — CID 87452583
2-[4-[3-(1-cyclopropylpiperidin-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]benzaldehyde (PubChem CID 87452583) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[4-[3-(1-cyclopropylpiperidin-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]benzaldehyde.
| Compound Name | 2-[4-[3-(1-cyclopropylpiperidin-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 87452583 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[4-[3-(1-cyclopropylpiperidin-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]benzaldehyde |
| SMILES | O=Cc1ccccc1-c1ccc(-c2nc(C3CCN(C4CC4)CC3)no2)cc1 |
| InChI | InChI=1S/C23H23N3O2/c27-15-19-3-1-2-4-21(19)16-5-7-18(8-6-16)23-24-22(25-28-23)17-11-13-26(14-12-17)20-9-10-20/h1-8,15,17,20H,9-14H2 |
| InChIKey | IYEQUUQTEAHGSO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|