C25H26F7N3O — CID 87452969
N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-4-(4-fluorophenyl)-N-methyl-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridine-5-carboxamide (PubChem CID 87452969) has the molecular formula C25H26F7N3O and a molecular weight of 517.49 g/mol. Its IUPAC name is N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-4-(4-fluorophenyl)-N-methyl-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridine-5-carboxamide.
| Compound Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-4-(4-fluorophenyl)-N-methyl-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 87452969 |
| Molecular Formula | C25H26F7N3O |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-4-(4-fluorophenyl)-N-methyl-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridine-5-carboxamide |
| SMILES | CN(CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)N1CCC2CNCC2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26F7N3O/c1-34(8-6-15-10-18(24(27,28)29)12-19(11-15)25(30,31)32)23(36)35-9-7-17-13-33-14-21(17)22(35)16-2-4-20(26)5-3-16/h2-5,10-12,17,21-22,33H,6-9,13-14H2,1H3 |
| InChIKey | ILVNNDMBFAIRAX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |