About butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid
butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid (PubChem CID 87452977) has the molecular formula C15H22O6
and a molecular weight of 298.34 g/mol. Its IUPAC name is butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid.
Molecular Properties
| Compound Name | butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid |
| PubChem CID | 87452977 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid |
| SMILES | C=C(CC=CC(=O)O)C(=O)OC.C=CC(=O)OCCCC |
| InChI | InChI=1S/C8H10O4.C7H12O2/c1-6(8(11)12-2)4-3-5-7(9)10;1-3-5-6-9-7(8)4-2/h3,5H,1,4H2,2H3,(H,9,10);4H,2-3,5-6H2,1H3 |
| InChIKey | WZUGYXGHABDFQT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid?
The IUPAC name of butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid (CID 87452977) is butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid.
What is the SMILES notation for butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid?
The canonical SMILES for butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid is C=C(CC=CC(=O)O)C(=O)OC.C=CC(=O)OCCCC.
What is the InChIKey of butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid?
The InChIKey is WZUGYXGHABDFQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4.C7H12O2/c1-6(8(11)12-2)4-3-5-7(9)10;1-3-5-6-9-7(8)4-2/h3,5H,1,4H2,2H3,(H,9,10);4H,2-3,5-6H2,1H3.
What are the key properties of butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid?
butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid has a molecular weight of 298.34 g/mol, XLogP of 2.26, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl prop-2-enoate;5-methoxycarbonylhexa-2,5-dienoic acid is sourced from PubChem (CID 87452977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).