C18H28F8O6Si2 — CID 87453054
trimethoxy-[1-(2,3,4,5,6-pentafluorophenyl)propyl]silane;trimethoxy(3,3,3-trifluoropropyl)silane (PubChem CID 87453054) has the molecular formula C18H28F8O6Si2 and a molecular weight of 548.57 g/mol. Its IUPAC name is trimethoxy-[1-(2,3,4,5,6-pentafluorophenyl)propyl]silane;trimethoxy(3,3,3-trifluoropropyl)silane.
| Compound Name | trimethoxy-[1-(2,3,4,5,6-pentafluorophenyl)propyl]silane;trimethoxy(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 87453054 |
| Molecular Formula | C18H28F8O6Si2 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | trimethoxy-[1-(2,3,4,5,6-pentafluorophenyl)propyl]silane;trimethoxy(3,3,3-trifluoropropyl)silane |
| SMILES | CCC(c1c(F)c(F)c(F)c(F)c1F)[Si](OC)(OC)OC.CO[Si](CCC(F)(F)F)(OC)OC |
| InChI | InChI=1S/C12H15F5O3Si.C6H13F3O3Si/c1-5-6(21(18-2,19-3)20-4)7-8(13)10(15)12(17)11(16)9(7)14;1-10-13(11-2,12-3)5-4-6(7,8)9/h6H,5H2,1-4H3;4-5H2,1-3H3 |
| InChIKey | WFZKMOYTBOXREW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|