C22H20FNOS2 — CID 87453201
(5E)-3-cyclohexyl-5-[[4-(4-fluorophenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 87453201) has the molecular formula C22H20FNOS2 and a molecular weight of 397.54 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-5-[[4-(4-fluorophenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-cyclohexyl-5-[[4-(4-fluorophenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 87453201 |
| Molecular Formula | C22H20FNOS2 |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (5E)-3-cyclohexyl-5-[[4-(4-fluorophenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(-c3ccc(F)cc3)cc2)SC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C22H20FNOS2/c23-18-12-10-17(11-13-18)16-8-6-15(7-9-16)14-20-21(25)24(22(26)27-20)19-4-2-1-3-5-19/h6-14,19H,1-5H2/b20-14+ |
| InChIKey | OTWFRFVARKYFLU-XSFVSMFZSA-N |
| XLogP | 6.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|