C44H72F2N14O6 — CID 87453748
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-[(2S,3S)-2,3,4-trimethylpiperazin-1-yl]pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 87453748) has the molecular formula C44H72F2N14O6 and a molecular weight of 931.15 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-[(2S,3S)-2,3,4-trimethylpiperazin-1-yl]pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-[(2S,3S)-2,3,4-trimethylpiperazin-1-yl]pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87453748 |
| Molecular Formula | C44H72F2N14O6 |
| Molecular Weight | 931.15 g/mol |
| Exact Mass | 930.57 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-[(2S,3S)-2,3,4-trimethylpiperazin-1-yl]pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | Cc1nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c(F)c(N2CCN(C)[C@@H](C)[C@@H]2C)n1.Cc1nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c(F)c(N2CCN(C)[C@@H](C)[C@@H]2C)n1 |
| InChI | InChI=1S/2C22H36FN7O3/c2*1-14-15(2)30(10-9-28(14)4)21-19(23)20(24-16(3)25-21)26-27-22(32)18(12-29(33)13-31)11-17-7-5-6-8-17/h2*13-15,17-18,33H,5-12H2,1-4H3,(H,27,32)(H,24,25,26)/t2*14-,15-,18+/m00/s1 |
| InChIKey | QGIRFUFSJVUKKP-MLGWWAEGSA-N |
| XLogP | 3.88 |
| TPSA | 227.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.15 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|