About 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine
4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine (PubChem CID 87453844) has the molecular formula C35H30N2O6
and a molecular weight of 574.63 g/mol. Its IUPAC name is 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine.
Molecular Properties
| Compound Name | 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine |
| PubChem CID | 87453844 |
| Molecular Formula | C35H30N2O6 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine |
| SMILES | Cc1cc(Oc2ccc(-c3ccc(OCC4CO4)cc3)cc2)nnc1Oc1ccc(-c2ccc(OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C35H30N2O6/c1-23-18-34(42-30-14-6-26(7-15-30)24-2-10-28(11-3-24)38-19-32-21-40-32)36-37-35(23)43-31-16-8-27(9-17-31)25-4-12-29(13-5-25)39-20-33-22-41-33/h2-18,32-33H,19-22H2,1H3 |
| InChIKey | BZXBJHCGPLOFBM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 87.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine?
The IUPAC name of 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine (CID 87453844) is 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine.
What is the SMILES notation for 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine?
The canonical SMILES for 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine is Cc1cc(Oc2ccc(-c3ccc(OCC4CO4)cc3)cc2)nnc1Oc1ccc(-c2ccc(OCC3CO3)cc2)cc1.
What is the InChIKey of 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine?
The InChIKey is BZXBJHCGPLOFBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H30N2O6/c1-23-18-34(42-30-14-6-26(7-15-30)24-2-10-28(11-3-24)38-19-32-21-40-32)36-37-35(23)43-31-16-8-27(9-17-31)25-4-12-29(13-5-25)39-20-33-22-41-33/h2-18,32-33H,19-22H2,1H3.
What are the key properties of 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine?
4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine has a molecular weight of 574.63 g/mol, XLogP of 7.26, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,6-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]pyridazine is sourced from PubChem (CID 87453844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).