C25H19N2O7S+ — CID 87454111
(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) 4-nitrosobenzenesulfonate (PubChem CID 87454111) has the molecular formula C25H19N2O7S+ and a molecular weight of 491.50 g/mol. Its IUPAC name is (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) 4-nitrosobenzenesulfonate.
| Compound Name | (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) 4-nitrosobenzenesulfonate |
|---|---|
| PubChem CID | 87454111 |
| Molecular Formula | C25H19N2O7S+ |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) 4-nitrosobenzenesulfonate |
| SMILES | COc1ccc2cc3[n+](cc2c1OS(=O)(=O)c1ccc(N=O)cc1)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C25H19N2O7S/c1-31-22-7-2-15-10-21-19-12-24-23(32-14-33-24)11-16(19)8-9-27(21)13-20(15)25(22)34-35(29,30)18-5-3-17(26-28)4-6-18/h2-7,10-13H,8-9,14H2,1H3/q+1 |
| InChIKey | JLXCZNGRZBOOGQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 104.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|