About quinolin-8-amine;quinoline-7-carbaldehyde
quinolin-8-amine;quinoline-7-carbaldehyde (PubChem CID 87454365) has the molecular formula C19H15N3O
and a molecular weight of 301.35 g/mol. Its IUPAC name is quinolin-8-amine;quinoline-7-carbaldehyde.
Molecular Properties
| Compound Name | quinolin-8-amine;quinoline-7-carbaldehyde |
| PubChem CID | 87454365 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | quinolin-8-amine;quinoline-7-carbaldehyde |
| SMILES | Nc1cccc2cccnc12.O=Cc1ccc2cccnc2c1 |
| InChI | InChI=1S/C10H7NO.C9H8N2/c12-7-8-3-4-9-2-1-5-11-10(9)6-8;10-8-5-1-3-7-4-2-6-11-9(7)8/h1-7H;1-6H,10H2 |
| InChIKey | PFBJUVWHMSCLHY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze quinolin-8-amine;quinoline-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-amine;quinoline-7-carbaldehyde?
The IUPAC name of quinolin-8-amine;quinoline-7-carbaldehyde (CID 87454365) is quinolin-8-amine;quinoline-7-carbaldehyde.
What is the SMILES notation for quinolin-8-amine;quinoline-7-carbaldehyde?
The canonical SMILES for quinolin-8-amine;quinoline-7-carbaldehyde is Nc1cccc2cccnc12.O=Cc1ccc2cccnc2c1.
What is the InChIKey of quinolin-8-amine;quinoline-7-carbaldehyde?
The InChIKey is PFBJUVWHMSCLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO.C9H8N2/c12-7-8-3-4-9-2-1-5-11-10(9)6-8;10-8-5-1-3-7-4-2-6-11-9(7)8/h1-7H;1-6H,10H2.
What are the key properties of quinolin-8-amine;quinoline-7-carbaldehyde?
quinolin-8-amine;quinoline-7-carbaldehyde has a molecular weight of 301.35 g/mol, XLogP of 3.86, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-amine;quinoline-7-carbaldehyde is sourced from PubChem (CID 87454365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).