C15H13N — CID 87454443
tricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaen-5-amine (PubChem CID 87454443) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is tricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaen-5-amine.
| Compound Name | tricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaen-5-amine |
|---|---|
| PubChem CID | 87454443 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | tricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaen-5-amine |
| SMILES | NC1=CCC2=c3ccccc3=CC=CC2=C1 |
| InChI | InChI=1S/C15H13N/c16-13-8-9-15-12(10-13)6-3-5-11-4-1-2-7-14(11)15/h1-8,10H,9,16H2 |
| InChIKey | FWGIYNOGLSMEMQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |