C23H30F3N3O3 — CID 87454782
N-[2-(cyclohexen-1-yl)-4-[1-[2-(2-hydroxyethylamino)acetyl]piperidin-4-yl]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 87454782) has the molecular formula C23H30F3N3O3 and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)-4-[1-[2-(2-hydroxyethylamino)acetyl]piperidin-4-yl]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)-4-[1-[2-(2-hydroxyethylamino)acetyl]piperidin-4-yl]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87454782 |
| Molecular Formula | C23H30F3N3O3 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)-4-[1-[2-(2-hydroxyethylamino)acetyl]piperidin-4-yl]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CNCCO)N1CCC(c2ccc(NC(=O)C(F)(F)F)c(C3=CCCCC3)c2)CC1 |
| InChI | InChI=1S/C23H30F3N3O3/c24-23(25,26)22(32)28-20-7-6-18(14-19(20)17-4-2-1-3-5-17)16-8-11-29(12-9-16)21(31)15-27-10-13-30/h4,6-7,14,16,27,30H,1-3,5,8-13,15H2,(H,28,32) |
| InChIKey | LWJXTXKYZRCCFY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|