C24H24N4O4 — CID 87454821
3-tert-butyl-5-(2,6-dioxo-1,3-diazinan-1-yl)-2-hydroxy-N-quinolin-6-ylbenzamide (PubChem CID 87454821) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-tert-butyl-5-(2,6-dioxo-1,3-diazinan-1-yl)-2-hydroxy-N-quinolin-6-ylbenzamide.
| Compound Name | 3-tert-butyl-5-(2,6-dioxo-1,3-diazinan-1-yl)-2-hydroxy-N-quinolin-6-ylbenzamide |
|---|---|
| PubChem CID | 87454821 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-tert-butyl-5-(2,6-dioxo-1,3-diazinan-1-yl)-2-hydroxy-N-quinolin-6-ylbenzamide |
| SMILES | CC(C)(C)c1cc(N2C(=O)CCNC2=O)cc(C(=O)Nc2ccc3ncccc3c2)c1O |
| InChI | InChI=1S/C24H24N4O4/c1-24(2,3)18-13-16(28-20(29)8-10-26-23(28)32)12-17(21(18)30)22(31)27-15-6-7-19-14(11-15)5-4-9-25-19/h4-7,9,11-13,30H,8,10H2,1-3H3,(H,26,32)(H,27,31) |
| InChIKey | MUVQEIONPCQGKN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |