C16H25N3O2 — CID 87454970
4-[2,2-bis(propylamino)ethyl]-7-hydroxy-1,3-dihydroindol-2-one (PubChem CID 87454970) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 4-[2,2-bis(propylamino)ethyl]-7-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 4-[2,2-bis(propylamino)ethyl]-7-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 87454970 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 4-[2,2-bis(propylamino)ethyl]-7-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CCCNC(Cc1ccc(O)c2c1CC(=O)N2)NCCC |
| InChI | InChI=1S/C16H25N3O2/c1-3-7-17-14(18-8-4-2)9-11-5-6-13(20)16-12(11)10-15(21)19-16/h5-6,14,17-18,20H,3-4,7-10H2,1-2H3,(H,19,21) |
| InChIKey | HIULWAYCTNGRRM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|