About 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate
2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate (PubChem CID 87455733) has the molecular formula C8H11F3N2O3
and a molecular weight of 240.18 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate |
| PubChem CID | 87455733 |
| Molecular Formula | C8H11F3N2O3 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate |
| SMILES | C[n+]1ccn(CCO)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C6H11N2O.C2HF3O2/c1-7-2-3-8(6-7)4-5-9;3-2(4,5)1(6)7/h2-3,6,9H,4-5H2,1H3;(H,6,7)/q+1;/p-1 |
| InChIKey | NBPXQMVKUZKMIE-UHFFFAOYSA-M |
| XLogP | -1.40 |
| TPSA | 69.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate?
The IUPAC name of 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate (CID 87455733) is 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate.
What is the SMILES notation for 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate?
The canonical SMILES for 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate is C[n+]1ccn(CCO)c1.O=C([O-])C(F)(F)F.
What is the InChIKey of 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate?
The InChIKey is NBPXQMVKUZKMIE-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11N2O.C2HF3O2/c1-7-2-3-8(6-7)4-5-9;3-2(4,5)1(6)7/h2-3,6,9H,4-5H2,1H3;(H,6,7)/q+1;/p-1.
What are the key properties of 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate?
2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate has a molecular weight of 240.18 g/mol, XLogP of -1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylimidazol-3-ium-1-yl)ethanol;2,2,2-trifluoroacetate is sourced from PubChem (CID 87455733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).