C31H27F7N4O2 — CID 87455767
(2S)-N-[1-cyano-2-(4-cyano-2,6-difluorophenyl)ethyl]-2-[[(1S)-1-[4-[4-(2,2-difluoro-2-hydroxyethyl)phenyl]phenyl]-2,2,2-trifluoroethyl]amino]-3-methylbutanamide (PubChem CID 87455767) has the molecular formula C31H27F7N4O2 and a molecular weight of 620.57 g/mol. Its IUPAC name is (2S)-N-[1-cyano-2-(4-cyano-2,6-difluorophenyl)ethyl]-2-[[(1S)-1-[4-[4-(2,2-difluoro-2-hydroxyethyl)phenyl]phenyl]-2,2,2-trifluoroethyl]amino]-3-methylbutanamide.
| Compound Name | (2S)-N-[1-cyano-2-(4-cyano-2,6-difluorophenyl)ethyl]-2-[[(1S)-1-[4-[4-(2,2-difluoro-2-hydroxyethyl)phenyl]phenyl]-2,2,2-trifluoroethyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 87455767 |
| Molecular Formula | C31H27F7N4O2 |
| Molecular Weight | 620.57 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | (2S)-N-[1-cyano-2-(4-cyano-2,6-difluorophenyl)ethyl]-2-[[(1S)-1-[4-[4-(2,2-difluoro-2-hydroxyethyl)phenyl]phenyl]-2,2,2-trifluoroethyl]amino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N[C@@H](c1ccc(-c2ccc(CC(O)(F)F)cc2)cc1)C(F)(F)F)C(=O)NC(C#N)Cc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C31H27F7N4O2/c1-17(2)27(29(43)41-23(16-40)13-24-25(32)11-19(15-39)12-26(24)33)42-28(31(36,37)38)22-9-7-21(8-10-22)20-5-3-18(4-6-20)14-30(34,35)44/h3-12,17,23,27-28,42,44H,13-14H2,1-2H3,(H,41,43)/t23?,27-,28-/m0/s1 |
| InChIKey | JOJFYMCKZDQMCN-HMCKCBAOSA-N |
| XLogP | 6.10 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |