C28H13F9O2 — CID 87457206
9,10-bis(2,6-difluoro-4-methoxyphenyl)-1,2,3,4,6-pentafluoroanthracene (PubChem CID 87457206) has the molecular formula C28H13F9O2 and a molecular weight of 552.39 g/mol. Its IUPAC name is 9,10-bis(2,6-difluoro-4-methoxyphenyl)-1,2,3,4,6-pentafluoroanthracene.
| Compound Name | 9,10-bis(2,6-difluoro-4-methoxyphenyl)-1,2,3,4,6-pentafluoroanthracene |
|---|---|
| PubChem CID | 87457206 |
| Molecular Formula | C28H13F9O2 |
| Molecular Weight | 552.39 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | 9,10-bis(2,6-difluoro-4-methoxyphenyl)-1,2,3,4,6-pentafluoroanthracene |
| SMILES | COc1cc(F)c(-c2c3ccc(F)cc3c(-c3c(F)cc(OC)cc3F)c3c(F)c(F)c(F)c(F)c23)c(F)c1 |
| InChI | InChI=1S/C28H13F9O2/c1-38-11-6-15(30)21(16(31)7-11)19-13-4-3-10(29)5-14(13)20(22-17(32)8-12(39-2)9-18(22)33)24-23(19)25(34)27(36)28(37)26(24)35/h3-9H,1-2H3 |
| InChIKey | ULVBIIBZQHNJLS-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.39 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|