C21H39O7P — CID 87457223
[(Z)-1-hydroxy-2,4-dioxohenicos-12-en-3-yl] dihydrogen phosphate (PubChem CID 87457223) has the molecular formula C21H39O7P and a molecular weight of 434.51 g/mol. Its IUPAC name is [(Z)-1-hydroxy-2,4-dioxohenicos-12-en-3-yl] dihydrogen phosphate.
| Compound Name | [(Z)-1-hydroxy-2,4-dioxohenicos-12-en-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87457223 |
| Molecular Formula | C21H39O7P |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | [(Z)-1-hydroxy-2,4-dioxohenicos-12-en-3-yl] dihydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(OP(=O)(O)O)C(=O)CO |
| InChI | InChI=1S/C21H39O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(23)21(20(24)18-22)28-29(25,26)27/h9-10,21-22H,2-8,11-18H2,1H3,(H2,25,26,27)/b10-9- |
| InChIKey | YHWDTKHRCSGPBA-KTKRTIGZSA-N |
| XLogP | 4.63 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|