About N-iodo-N-phenylaniline
N-iodo-N-phenylaniline (PubChem CID 87457232) has the molecular formula C12H10IN
and a molecular weight of 295.12 g/mol. Its IUPAC name is N-iodo-N-phenylaniline.
Molecular Properties
| Compound Name | N-iodo-N-phenylaniline |
| PubChem CID | 87457232 |
| Molecular Formula | C12H10IN |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | N-iodo-N-phenylaniline |
| SMILES | IN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10IN/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RHQYLZRLLIXIME-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-N-phenylaniline?
The IUPAC name of N-iodo-N-phenylaniline (CID 87457232) is N-iodo-N-phenylaniline.
What is the SMILES notation for N-iodo-N-phenylaniline?
The canonical SMILES for N-iodo-N-phenylaniline is IN(c1ccccc1)c1ccccc1.
What is the InChIKey of N-iodo-N-phenylaniline?
The InChIKey is RHQYLZRLLIXIME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10IN/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H.
What are the key properties of N-iodo-N-phenylaniline?
N-iodo-N-phenylaniline has a molecular weight of 295.12 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-N-phenylaniline is sourced from PubChem (CID 87457232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).