C22H14F6N4O — CID 87457278
2-[4-(3,5-dipyridin-2-ylpyrazol-1-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 87457278) has the molecular formula C22H14F6N4O and a molecular weight of 464.37 g/mol. Its IUPAC name is 2-[4-(3,5-dipyridin-2-ylpyrazol-1-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-(3,5-dipyridin-2-ylpyrazol-1-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 87457278 |
| Molecular Formula | C22H14F6N4O |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-[4-(3,5-dipyridin-2-ylpyrazol-1-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccc(-n2nc(-c3ccccn3)cc2-c2ccccn2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H14F6N4O/c23-21(24,25)20(33,22(26,27)28)14-7-9-15(10-8-14)32-19(17-6-2-4-12-30-17)13-18(31-32)16-5-1-3-11-29-16/h1-13,33H |
| InChIKey | GKVWSMVRCQKIBF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |