C27H13F7O — CID 87457374
9-(2,6-difluoro-4-methoxyphenyl)-10-(3,4-difluorophenyl)-1,4,6-trifluoroanthracene (PubChem CID 87457374) has the molecular formula C27H13F7O and a molecular weight of 486.39 g/mol. Its IUPAC name is 9-(2,6-difluoro-4-methoxyphenyl)-10-(3,4-difluorophenyl)-1,4,6-trifluoroanthracene.
| Compound Name | 9-(2,6-difluoro-4-methoxyphenyl)-10-(3,4-difluorophenyl)-1,4,6-trifluoroanthracene |
|---|---|
| PubChem CID | 87457374 |
| Molecular Formula | C27H13F7O |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 9-(2,6-difluoro-4-methoxyphenyl)-10-(3,4-difluorophenyl)-1,4,6-trifluoroanthracene |
| SMILES | COc1cc(F)c(-c2c3ccc(F)cc3c(-c3ccc(F)c(F)c3)c3c(F)ccc(F)c23)c(F)c1 |
| InChI | InChI=1S/C27H13F7O/c1-35-14-10-21(33)25(22(34)11-14)24-15-4-3-13(28)9-16(15)23(12-2-5-17(29)20(32)8-12)26-18(30)6-7-19(31)27(24)26/h2-11H,1H3 |
| InChIKey | ATBUEGKQWTYDJG-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|