C66H72N2O2S6 — CID 87457380
2,5-dihexyl-1,4-bis[4-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 87457380) has the molecular formula C66H72N2O2S6 and a molecular weight of 1117.72 g/mol. Its IUPAC name is 2,5-dihexyl-1,4-bis[4-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-dihexyl-1,4-bis[4-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 87457380 |
| Molecular Formula | C66H72N2O2S6 |
| Molecular Weight | 1117.72 g/mol |
| Exact Mass | 1116.39 |
| IUPAC Name | 2,5-dihexyl-1,4-bis[4-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(C5=C6C(=O)N(CCCCCC)C(c7ccc(-c8ccc(-c9ccc(-c%10ccc(CCCCCC)s%10)s9)s8)cc7)=C6C(=O)N5CCCCCC)cc4)s3)s2)s1 |
| InChI | InChI=1S/C66H72N2O2S6/c1-5-9-13-17-21-49-31-33-53(71-49)55-39-41-59(75-55)57-37-35-51(73-57)45-23-27-47(28-24-45)63-61-62(66(70)67(63)43-19-15-11-7-3)64(68(65(61)69)44-20-16-12-8-4)48-29-25-46(26-30-48)52-36-38-58(74-52)60-42-40-56(76-60)54-34-32-50(72-54)22-18-14-10-6-2/h23-42H,5-22,43-44H2,1-4H3 |
| InChIKey | REQGXQHPPGXNRZ-UHFFFAOYSA-N |
| XLogP | 21.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1117.72 |
| LogP ≤ 5 | 21.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|