C19H22F6N2O4 — CID 87457421
5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(pyrrolidine-1-carbonyl)anilino]pentanoic acid (PubChem CID 87457421) has the molecular formula C19H22F6N2O4 and a molecular weight of 456.38 g/mol. Its IUPAC name is 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(pyrrolidine-1-carbonyl)anilino]pentanoic acid.
| Compound Name | 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(pyrrolidine-1-carbonyl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 87457421 |
| Molecular Formula | C19H22F6N2O4 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(pyrrolidine-1-carbonyl)anilino]pentanoic acid |
| SMILES | O=C(O)CCCCN(C(=O)N1CCCC1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F6N2O4/c20-18(21,22)17(31,19(23,24)25)13-6-8-14(9-7-13)27(12-2-1-5-15(28)29)16(30)26-10-3-4-11-26/h6-9,31H,1-5,10-12H2,(H,28,29) |
| InChIKey | KBPLMXRAVOKXQT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|