C12H11Cl3N10 — CID 87457442
4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;1,3,5-triazine-2,4,6-triamine (PubChem CID 87457442) has the molecular formula C12H11Cl3N10 and a molecular weight of 401.65 g/mol. Its IUPAC name is 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 87457442 |
| Molecular Formula | C12H11Cl3N10 |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;1,3,5-triazine-2,4,6-triamine |
| SMILES | Clc1nc(Cl)nc(Nc2ccccc2Cl)n1.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C9H5Cl3N4.C3H6N6/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9;4-1-7-2(5)9-3(6)8-1/h1-4H,(H,13,14,15,16);(H6,4,5,6,7,8,9) |
| InChIKey | BHFNXIHYSVUNCO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 167.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |