About benzenesulfonate;pyrrolidin-1-ium
benzenesulfonate;pyrrolidin-1-ium (PubChem CID 87457667) has the molecular formula C10H15NO3S
and a molecular weight of 229.30 g/mol. Its IUPAC name is benzenesulfonate;pyrrolidin-1-ium.
Molecular Properties
| Compound Name | benzenesulfonate;pyrrolidin-1-ium |
| PubChem CID | 87457667 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | benzenesulfonate;pyrrolidin-1-ium |
| SMILES | C1CC[NH2+]C1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C6H6O3S.C4H9N/c7-10(8,9)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H,(H,7,8,9);5H,1-4H2 |
| InChIKey | FFVMTMOJVZYJAF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonate;pyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonate;pyrrolidin-1-ium?
The IUPAC name of benzenesulfonate;pyrrolidin-1-ium (CID 87457667) is benzenesulfonate;pyrrolidin-1-ium.
What is the SMILES notation for benzenesulfonate;pyrrolidin-1-ium?
The canonical SMILES for benzenesulfonate;pyrrolidin-1-ium is C1CC[NH2+]C1.O=S(=O)([O-])c1ccccc1.
What is the InChIKey of benzenesulfonate;pyrrolidin-1-ium?
The InChIKey is FFVMTMOJVZYJAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3S.C4H9N/c7-10(8,9)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H,(H,7,8,9);5H,1-4H2.
What are the key properties of benzenesulfonate;pyrrolidin-1-ium?
benzenesulfonate;pyrrolidin-1-ium has a molecular weight of 229.30 g/mol, XLogP of -0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonate;pyrrolidin-1-ium is sourced from PubChem (CID 87457667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).