C25H33NO4Si — CID 87457698
[(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-(2-oxoethyl)cyclohexyl]carbamic acid (PubChem CID 87457698) has the molecular formula C25H33NO4Si and a molecular weight of 439.63 g/mol. Its IUPAC name is [(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-(2-oxoethyl)cyclohexyl]carbamic acid.
| Compound Name | [(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-(2-oxoethyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 87457698 |
| Molecular Formula | C25H33NO4Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | [(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-(2-oxoethyl)cyclohexyl]carbamic acid |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC[C@H](CC=O)C[C@H]1NC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33NO4Si/c1-25(2,3)31(20-10-6-4-7-11-20,21-12-8-5-9-13-21)30-23-15-14-19(16-17-27)18-22(23)26-24(28)29/h4-13,17,19,22-23,26H,14-16,18H2,1-3H3,(H,28,29)/t19-,22-,23-/m1/s1 |
| InChIKey | KPAGDEATJJYPRL-UEVCKROQSA-N |
| XLogP | 3.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|