About 2-methylpyrrolidin-1-ium tetrafluoroborate
2-methylpyrrolidin-1-ium tetrafluoroborate (PubChem CID 87457788) has the molecular formula C5H12BF4N
and a molecular weight of 172.96 g/mol. Its IUPAC name is 2-methylpyrrolidin-1-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 2-methylpyrrolidin-1-ium tetrafluoroborate |
| PubChem CID | 87457788 |
| Molecular Formula | C5H12BF4N |
| Molecular Weight | 172.96 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2-methylpyrrolidin-1-ium tetrafluoroborate |
| SMILES | CC1CCC[NH2+]1.F[B-](F)(F)F |
| InChI | InChI=1S/C5H11N.BF4/c1-5-3-2-4-6-5;2-1(3,4)5/h5-6H,2-4H2,1H3;/q;-1/p+1 |
| InChIKey | MERVZNDRBDYZDB-UHFFFAOYSA-O |
| XLogP | 1.03 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.96 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpyrrolidin-1-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyrrolidin-1-ium tetrafluoroborate?
The IUPAC name of 2-methylpyrrolidin-1-ium tetrafluoroborate (CID 87457788) is 2-methylpyrrolidin-1-ium tetrafluoroborate.
What is the SMILES notation for 2-methylpyrrolidin-1-ium tetrafluoroborate?
The canonical SMILES for 2-methylpyrrolidin-1-ium tetrafluoroborate is CC1CCC[NH2+]1.F[B-](F)(F)F.
What is the InChIKey of 2-methylpyrrolidin-1-ium tetrafluoroborate?
The InChIKey is MERVZNDRBDYZDB-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H11N.BF4/c1-5-3-2-4-6-5;2-1(3,4)5/h5-6H,2-4H2,1H3;/q;-1/p+1.
What are the key properties of 2-methylpyrrolidin-1-ium tetrafluoroborate?
2-methylpyrrolidin-1-ium tetrafluoroborate has a molecular weight of 172.96 g/mol, XLogP of 1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyrrolidin-1-ium tetrafluoroborate is sourced from PubChem (CID 87457788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).