About bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium
bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium (PubChem CID 87458051) has the molecular formula C10H18F6N2O4S2
and a molecular weight of 408.39 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium |
| PubChem CID | 87458051 |
| Molecular Formula | C10H18F6N2O4S2 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium |
| SMILES | CCCCC1CC[NH2+]C1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H17N.C2F6NO4S2/c1-2-3-4-8-5-6-9-7-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h8-9H,2-7H2,1H3;/q;-1/p+1 |
| InChIKey | INSKRMDYTHCZMZ-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium (CID 87458051) is bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium is CCCCC1CC[NH2+]C1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium?
The InChIKey is INSKRMDYTHCZMZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H17N.C2F6NO4S2/c1-2-3-4-8-5-6-9-7-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h8-9H,2-7H2,1H3;/q;-1/p+1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium?
bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium has a molecular weight of 408.39 g/mol, XLogP of 1.82, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;3-butylpyrrolidin-1-ium is sourced from PubChem (CID 87458051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).