About 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate)
1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate) (PubChem CID 87458284) has the molecular formula C13H20F6O7S4
and a molecular weight of 530.55 g/mol. Its IUPAC name is 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate).
Molecular Properties
| Compound Name | 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate) |
| PubChem CID | 87458284 |
| Molecular Formula | C13H20F6O7S4 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.00 |
| IUPAC Name | 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate) |
| SMILES | O=C(C[S+]1CCCC1)C[S+]1CCCC1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H20OS2.2CHF3O3S/c12-11(9-13-5-1-2-6-13)10-14-7-3-4-8-14;2*2-1(3,4)8(5,6)7/h1-10H2;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | SZEAMQWFIVNQDK-UHFFFAOYSA-L |
| XLogP | 1.48 |
| TPSA | 131.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate)?
The IUPAC name of 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate) (CID 87458284) is 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate).
What is the SMILES notation for 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate)?
The canonical SMILES for 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate) is O=C(C[S+]1CCCC1)C[S+]1CCCC1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate)?
The InChIKey is SZEAMQWFIVNQDK-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H20OS2.2CHF3O3S/c12-11(9-13-5-1-2-6-13)10-14-7-3-4-8-14;2*2-1(3,4)8(5,6)7/h1-10H2;2*(H,5,6,7)/q+2;;/p-2.
What are the key properties of 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate)?
1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate) has a molecular weight of 530.55 g/mol, XLogP of 1.48, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(thiolan-1-ium-1-yl)propan-2-one;bis(trifluoromethanesulfonate) is sourced from PubChem (CID 87458284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).