C41H44F3N3O9S — CID 87458723
N-[3-[1-[5-[bis(4-methoxyphenyl)-[methoxy(phenyl)methoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(methanesulfonamido)indol-3-yl]propyl]-2,2,2-trifluoroacetamide (PubChem CID 87458723) has the molecular formula C41H44F3N3O9S and a molecular weight of 811.88 g/mol. Its IUPAC name is N-[3-[1-[5-[bis(4-methoxyphenyl)-[methoxy(phenyl)methoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(methanesulfonamido)indol-3-yl]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[1-[5-[bis(4-methoxyphenyl)-[methoxy(phenyl)methoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(methanesulfonamido)indol-3-yl]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87458723 |
| Molecular Formula | C41H44F3N3O9S |
| Molecular Weight | 811.88 g/mol |
| Exact Mass | 811.28 |
| IUPAC Name | N-[3-[1-[5-[bis(4-methoxyphenyl)-[methoxy(phenyl)methoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(methanesulfonamido)indol-3-yl]propyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(C(OC(OC)c2ccccc2)(c2ccc(OC)cc2)C2OC(n3cc(CCCNC(=O)C(F)(F)F)c4cc(NS(C)(=O)=O)ccc43)CC2O)cc1 |
| InChI | InChI=1S/C41H44F3N3O9S/c1-52-31-17-12-28(13-18-31)40(29-14-19-32(53-2)20-15-29,56-38(54-3)26-9-6-5-7-10-26)37-35(48)24-36(55-37)47-25-27(11-8-22-45-39(49)41(42,43)44)33-23-30(16-21-34(33)47)46-57(4,50)51/h5-7,9-10,12-21,23,25,35-38,46,48H,8,11,22,24H2,1-4H3,(H,45,49) |
| InChIKey | QJSUZUXHFLDVIH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 146.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.88 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|