C34H52N18O2 — CID 87459298
1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-10-N'-(3,5-diacetylphenyl)-1-N,10-N-bis(diaminomethylideneamino)decanediimidamide (PubChem CID 87459298) has the molecular formula C34H52N18O2 and a molecular weight of 744.91 g/mol. Its IUPAC name is 1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-10-N'-(3,5-diacetylphenyl)-1-N,10-N-bis(diaminomethylideneamino)decanediimidamide.
| Compound Name | 1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-10-N'-(3,5-diacetylphenyl)-1-N,10-N-bis(diaminomethylideneamino)decanediimidamide |
|---|---|
| PubChem CID | 87459298 |
| Molecular Formula | C34H52N18O2 |
| Molecular Weight | 744.91 g/mol |
| Exact Mass | 744.45 |
| IUPAC Name | 1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-10-N'-(3,5-diacetylphenyl)-1-N,10-N-bis(diaminomethylideneamino)decanediimidamide |
| SMILES | CC(=O)c1cc(/N=C(/CCCCCCCC/C(=N\c2cc(C(C)=NN=C(N)N)cc(C(C)=NN=C(N)N)c2)NN=C(N)N)NN=C(N)N)cc(C(C)=O)c1 |
| InChI | InChI=1S/C34H52N18O2/c1-19(45-49-31(35)36)23-13-24(20(2)46-50-32(37)38)16-27(15-23)43-29(47-51-33(39)40)11-9-7-5-6-8-10-12-30(48-52-34(41)42)44-28-17-25(21(3)53)14-26(18-28)22(4)54/h13-18H,5-12H2,1-4H3,(H,43,47)(H,44,48)(H4,35,36,49)(H4,37,38,50)(H4,39,40,51)(H4,41,42,52) |
| InChIKey | OMEYSVSXHHNQLL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 365.24 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.91 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|