C13H11NO5S — CID 87459363
3-[5-(thiophen-2-ylmethyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid (PubChem CID 87459363) has the molecular formula C13H11NO5S and a molecular weight of 293.30 g/mol. Its IUPAC name is 3-[5-(thiophen-2-ylmethyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid.
| Compound Name | 3-[5-(thiophen-2-ylmethyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 87459363 |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-[5-(thiophen-2-ylmethyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2OOC(Cc3cccs3)O2)c1 |
| InChI | InChI=1S/C13H11NO5S/c15-13(16)9-3-1-4-10(7-9)14-17-12(18-19-14)8-11-5-2-6-20-11/h1-7,12H,8H2,(H,15,16) |
| InChIKey | HRDHZCFSLBZQIQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|