C16H19NO5 — CID 87459533
benzenecarboperoxoic acid;2-(4-methylanilino)ethane-1,1-diol (PubChem CID 87459533) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is benzenecarboperoxoic acid;2-(4-methylanilino)ethane-1,1-diol.
| Compound Name | benzenecarboperoxoic acid;2-(4-methylanilino)ethane-1,1-diol |
|---|---|
| PubChem CID | 87459533 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | benzenecarboperoxoic acid;2-(4-methylanilino)ethane-1,1-diol |
| SMILES | Cc1ccc(NCC(O)O)cc1.O=C(OO)c1ccccc1 |
| InChI | InChI=1S/C9H13NO2.C7H6O3/c1-7-2-4-8(5-3-7)10-6-9(11)12;8-7(10-9)6-4-2-1-3-5-6/h2-5,9-12H,6H2,1H3;1-5,9H |
| InChIKey | KBRKYKFCJLUTMG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|