C17H12BrNO4S — CID 87459693
ethyl 3-bromo-7-(4-formylphenyl)-6-oxothieno[2,3-b]pyridine-2-carboxylate (PubChem CID 87459693) has the molecular formula C17H12BrNO4S and a molecular weight of 406.26 g/mol. Its IUPAC name is ethyl 3-bromo-7-(4-formylphenyl)-6-oxothieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 3-bromo-7-(4-formylphenyl)-6-oxothieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 87459693 |
| Molecular Formula | C17H12BrNO4S |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | ethyl 3-bromo-7-(4-formylphenyl)-6-oxothieno[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(ccc(=O)n2-c2ccc(C=O)cc2)c1Br |
| InChI | InChI=1S/C17H12BrNO4S/c1-2-23-17(22)15-14(18)12-7-8-13(21)19(16(12)24-15)11-5-3-10(9-20)4-6-11/h3-9H,2H2,1H3 |
| InChIKey | OGHNJLFRCDZJFB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|