C15H12ClNO5 — CID 87459981
3-[5-[(4-chlorophenyl)methyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid (PubChem CID 87459981) has the molecular formula C15H12ClNO5 and a molecular weight of 321.72 g/mol. Its IUPAC name is 3-[5-[(4-chlorophenyl)methyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid.
| Compound Name | 3-[5-[(4-chlorophenyl)methyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 87459981 |
| Molecular Formula | C15H12ClNO5 |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 3-[5-[(4-chlorophenyl)methyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2OOC(Cc3ccc(Cl)cc3)O2)c1 |
| InChI | InChI=1S/C15H12ClNO5/c16-12-6-4-10(5-7-12)8-14-20-17(22-21-14)13-3-1-2-11(9-13)15(18)19/h1-7,9,14H,8H2,(H,18,19) |
| InChIKey | NCQDVHFNVIXRFV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|