C20H19F17N2O3 — CID 87460026
1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-N,N-bis(2-hydroxyethyl)-2H-pyridine-4-carboxamide (PubChem CID 87460026) has the molecular formula C20H19F17N2O3 and a molecular weight of 658.35 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-N,N-bis(2-hydroxyethyl)-2H-pyridine-4-carboxamide.
| Compound Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-N,N-bis(2-hydroxyethyl)-2H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 87460026 |
| Molecular Formula | C20H19F17N2O3 |
| Molecular Weight | 658.35 g/mol |
| Exact Mass | 658.11 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-N,N-bis(2-hydroxyethyl)-2H-pyridine-4-carboxamide |
| SMILES | O=C(C1=CCN(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C=C1)N(CCO)CCO |
| InChI | InChI=1S/C20H19F17N2O3/c21-13(22,3-6-38-4-1-11(2-5-38)12(42)39(7-9-40)8-10-41)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h1-2,4,40-41H,3,5-10H2 |
| InChIKey | YWINRQMGFDHOPJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|