C15H17BrN2O3 — CID 87460262
ethyl 7-bromo-1-tert-butyl-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 87460262) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is ethyl 7-bromo-1-tert-butyl-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-bromo-1-tert-butyl-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 87460262 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | ethyl 7-bromo-1-tert-butyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C(C)(C)C)c2nc(Br)ccc2c1=O |
| InChI | InChI=1S/C15H17BrN2O3/c1-5-21-14(20)10-8-18(15(2,3)4)13-9(12(10)19)6-7-11(16)17-13/h6-8H,5H2,1-4H3 |
| InChIKey | QTGQADJOHUHHEK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|