C22H22F5IN2O4S — CID 87460613
3-iodo-1-N-(2-methyl-1-methylsulfonylpropan-2-yl)-1-N-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzene-1,2-dicarboxamide (PubChem CID 87460613) has the molecular formula C22H22F5IN2O4S and a molecular weight of 632.39 g/mol. Its IUPAC name is 3-iodo-1-N-(2-methyl-1-methylsulfonylpropan-2-yl)-1-N-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzene-1,2-dicarboxamide.
| Compound Name | 3-iodo-1-N-(2-methyl-1-methylsulfonylpropan-2-yl)-1-N-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87460613 |
| Molecular Formula | C22H22F5IN2O4S |
| Molecular Weight | 632.39 g/mol |
| Exact Mass | 632.03 |
| IUPAC Name | 3-iodo-1-N-(2-methyl-1-methylsulfonylpropan-2-yl)-1-N-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzene-1,2-dicarboxamide |
| SMILES | Cc1cc(C(F)(F)C(F)(F)F)ccc1N(C(=O)c1cccc(I)c1C(N)=O)C(C)(C)CS(C)(=O)=O |
| InChI | InChI=1S/C22H22F5IN2O4S/c1-12-10-13(21(23,24)22(25,26)27)8-9-16(12)30(20(2,3)11-35(4,33)34)19(32)14-6-5-7-15(28)17(14)18(29)31/h5-10H,11H2,1-4H3,(H2,29,31) |
| InChIKey | VCLNWFYCUBUOOP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|